C52H68N4O5 — CID 144758590
2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetic acid;1-tert-butyl-4-methylbenzene;ethane (PubChem CID 144758590) has the molecular formula C52H68N4O5 and a molecular weight of 829.14 g/mol. Its IUPAC name is 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetic acid;1-tert-butyl-4-methylbenzene;ethane.
| Compound Name | 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetic acid;1-tert-butyl-4-methylbenzene;ethane |
|---|---|
| PubChem CID | 144758590 |
| Molecular Formula | C52H68N4O5 |
| Molecular Weight | 829.14 g/mol |
| Exact Mass | 828.52 |
| IUPAC Name | 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]acetic acid;1-tert-butyl-4-methylbenzene;ethane |
| SMILES | CC.CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)NCC(=O)O)cc3)nc2)cc1.Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C39H46N4O5.C11H16.C2H6/c1-5-6-7-8-9-22-48-33-20-16-28(17-21-33)31-24-40-36(41-25-31)29-12-10-27(11-13-29)23-34(38(47)42-26-35(44)45)43-37(46)30-14-18-32(19-15-30)39(2,3)4;1-9-5-7-10(8-6-9)11(2,3)4;1-2/h10-21,24-25,34H,5-9,22-23,26H2,1-4H3,(H,42,47)(H,43,46)(H,44,45);5-8H,1-4H3;1-2H3 |
| InChIKey | ILJDPJLSHWIDTI-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.14 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|