C41H50N4O3 — CID 144758545
4-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide (PubChem CID 144758545) has the molecular formula C41H50N4O3 and a molecular weight of 646.88 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 144758545 |
| Molecular Formula | C41H50N4O3 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.39 |
| IUPAC Name | 4-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]benzamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)N4CCCC4)cc3)nc2)cc1 |
| InChI | InChI=1S/C41H50N4O3/c1-5-6-7-8-11-26-48-36-22-18-31(19-23-36)34-28-42-38(43-29-34)32-14-12-30(13-15-32)27-37(40(47)45-24-9-10-25-45)44-39(46)33-16-20-35(21-17-33)41(2,3)4/h12-23,28-29,37H,5-11,24-27H2,1-4H3,(H,44,46) |
| InChIKey | YMSLVIIYPSCUNQ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|