C43H54N4O5 — CID 123588032
2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3,3-dimethylbutanoic acid (PubChem CID 123588032) has the molecular formula C43H54N4O5 and a molecular weight of 706.93 g/mol. Its IUPAC name is 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 123588032 |
| Molecular Formula | C43H54N4O5 |
| Molecular Weight | 706.93 g/mol |
| Exact Mass | 706.41 |
| IUPAC Name | 2-[[2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3,3-dimethylbutanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)NC(C(=O)O)C(C)(C)C)cc3)nc2)cc1 |
| InChI | InChI=1S/C43H54N4O5/c1-8-9-10-11-12-25-52-35-23-19-30(20-24-35)33-27-44-38(45-28-33)31-15-13-29(14-16-31)26-36(40(49)47-37(41(50)51)43(5,6)7)46-39(48)32-17-21-34(22-18-32)42(2,3)4/h13-24,27-28,36-37H,8-12,25-26H2,1-7H3,(H,46,48)(H,47,49)(H,50,51) |
| InChIKey | BVEMXAUSKJDUTH-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.93 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|