C42H52N4O5 — CID 122469853
(2S)-4-amino-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)-2-pyridinyl]phenyl]propanoyl]amino]butanoic acid (PubChem CID 122469853) has the molecular formula C42H52N4O5 and a molecular weight of 692.90 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)-2-pyridinyl]phenyl]propanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)-2-pyridinyl]phenyl]propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122469853 |
| Molecular Formula | C42H52N4O5 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.39 |
| IUPAC Name | (2S)-4-amino-2-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)-2-pyridinyl]phenyl]propanoyl]amino]butanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(C[C@H](NC(=O)c4ccc(C(C)(C)C)cc4)C(=O)N[C@@H](CCN)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C42H52N4O5/c1-5-6-7-8-9-26-51-35-21-16-30(17-22-35)33-18-23-36(44-28-33)31-12-10-29(11-13-31)27-38(40(48)45-37(24-25-43)41(49)50)46-39(47)32-14-19-34(20-15-32)42(2,3)4/h10-23,28,37-38H,5-9,24-27,43H2,1-4H3,(H,45,48)(H,46,47)(H,49,50)/t37-,38-/m0/s1 |
| InChIKey | NNIOXHIMQAIFAS-UWXQCODUSA-N |
| XLogP | 7.32 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|