C40H50N4O5S — CID 123320051
2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]pentanoic acid (PubChem CID 123320051) has the molecular formula C40H50N4O5S and a molecular weight of 698.93 g/mol. Its IUPAC name is 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 123320051 |
| Molecular Formula | C40H50N4O5S |
| Molecular Weight | 698.93 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]pentanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NC(CCC)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C40H50N4O5S/c1-6-8-9-10-11-23-49-31-19-17-28(18-20-31)30-25-41-36(42-26-30)29-15-13-27(14-16-29)24-33(37(45)43-32(12-7-2)39(47)48)44-38(46)34-21-22-35(50-34)40(3,4)5/h13-22,25-26,32-33H,6-12,23-24H2,1-5H3,(H,43,45)(H,44,46)(H,47,48) |
| InChIKey | QRUSLHDDDNOUON-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.93 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|