C44H50N4O7S — CID 123512480
2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid (PubChem CID 123512480) has the molecular formula C44H50N4O7S and a molecular weight of 778.97 g/mol. Its IUPAC name is 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 123512480 |
| Molecular Formula | C44H50N4O7S |
| Molecular Weight | 778.97 g/mol |
| Exact Mass | 778.34 |
| IUPAC Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(3,4-dihydroxyphenyl)propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NC(Cc4ccc(O)c(O)c4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C44H50N4O7S/c1-5-6-7-8-9-22-55-33-17-15-30(16-18-33)32-26-45-40(46-27-32)31-13-10-28(11-14-31)23-34(47-42(52)38-20-21-39(56-38)44(2,3)4)41(51)48-35(43(53)54)24-29-12-19-36(49)37(50)25-29/h10-21,25-27,34-35,49-50H,5-9,22-24H2,1-4H3,(H,47,52)(H,48,51)(H,53,54) |
| InChIKey | QPKRGIHWSDEKTE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.97 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|