C33H35N3O5S — CID 123719861
2-[(5-acetylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 123719861) has the molecular formula C33H35N3O5S and a molecular weight of 585.73 g/mol. Its IUPAC name is 2-[(5-acetylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | 2-[(5-acetylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123719861 |
| Molecular Formula | C33H35N3O5S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 2-[(5-acetylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)=O)s4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H35N3O5S/c1-3-4-5-6-7-18-41-27-14-12-24(13-15-27)26-20-34-31(35-21-26)25-10-8-23(9-11-25)19-28(33(39)40)36-32(38)30-17-16-29(42-30)22(2)37/h8-17,20-21,28H,3-7,18-19H2,1-2H3,(H,36,38)(H,39,40) |
| InChIKey | UEKGLERIPKJOGN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|