C34H40N4O4S — CID 122447231
2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(5-heptoxy-2-pyridinyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 122447231) has the molecular formula C34H40N4O4S and a molecular weight of 600.79 g/mol. Its IUPAC name is 2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(5-heptoxy-2-pyridinyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | 2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(5-heptoxy-2-pyridinyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122447231 |
| Molecular Formula | C34H40N4O4S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(5-heptoxy-2-pyridinyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)O)cc3)nc2)nc1 |
| InChI | InChI=1S/C34H40N4O4S/c1-5-6-7-8-9-18-42-26-14-15-27(35-22-26)25-20-36-31(37-21-25)24-12-10-23(11-13-24)19-28(33(40)41)38-32(39)29-16-17-30(43-29)34(2,3)4/h10-17,20-22,28H,5-9,18-19H2,1-4H3,(H,38,39)(H,40,41) |
| InChIKey | NZTLBRAFIQJZFG-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|