C41H50N4O7S3 — CID 135264287
(2R)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(2-carboxyethyldisulfanyl)propanoic acid (PubChem CID 135264287) has the molecular formula C41H50N4O7S3 and a molecular weight of 807.07 g/mol. Its IUPAC name is (2R)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(2-carboxyethyldisulfanyl)propanoic acid.
| Compound Name | (2R)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(2-carboxyethyldisulfanyl)propanoic acid |
|---|---|
| PubChem CID | 135264287 |
| Molecular Formula | C41H50N4O7S3 |
| Molecular Weight | 807.07 g/mol |
| Exact Mass | 806.28 |
| IUPAC Name | (2R)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-3-(2-carboxyethyldisulfanyl)propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)N[C@@H](CSSCCC(=O)O)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C41H50N4O7S3/c1-5-6-7-8-9-21-52-31-16-14-28(15-17-31)30-24-42-37(43-25-30)29-12-10-27(11-13-29)23-32(44-39(49)34-18-19-35(55-34)41(2,3)4)38(48)45-33(40(50)51)26-54-53-22-20-36(46)47/h10-19,24-25,32-33H,5-9,20-23,26H2,1-4H3,(H,44,49)(H,45,48)(H,46,47)(H,50,51)/t32?,33-/m0/s1 |
| InChIKey | OMAONYGCDWGXPW-OBOZPERJSA-N |
| XLogP | 8.29 |
| TPSA | 167.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.07 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|