C39H49N5O4S — CID 123237258
N-[1-(2-acetamidoethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-5-tert-butylthiophene-2-carboxamide (PubChem CID 123237258) has the molecular formula C39H49N5O4S and a molecular weight of 683.92 g/mol. Its IUPAC name is N-[1-(2-acetamidoethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-5-tert-butylthiophene-2-carboxamide.
| Compound Name | N-[1-(2-acetamidoethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-5-tert-butylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 123237258 |
| Molecular Formula | C39H49N5O4S |
| Molecular Weight | 683.92 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | N-[1-(2-acetamidoethylamino)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxopropan-2-yl]-5-tert-butylthiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NCCNC(C)=O)cc3)nc2)cc1 |
| InChI | InChI=1S/C39H49N5O4S/c1-6-7-8-9-10-23-48-32-17-15-29(16-18-32)31-25-42-36(43-26-31)30-13-11-28(12-14-30)24-33(37(46)41-22-21-40-27(2)45)44-38(47)34-19-20-35(49-34)39(3,4)5/h11-20,25-26,33H,6-10,21-24H2,1-5H3,(H,40,45)(H,41,46)(H,44,47) |
| InChIKey | YZQYMLJJLYMHLO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.92 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|