C35H41N3O3S — CID 144758610
5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 144758610) has the molecular formula C35H41N3O3S and a molecular weight of 583.80 g/mol. Its IUPAC name is 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 144758610 |
| Molecular Formula | C35H41N3O3S |
| Molecular Weight | 583.80 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(C=O)NC(=O)c4ccc(C(C)(C)C)s4)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H41N3O3S/c1-5-6-7-8-9-20-41-30-16-14-26(15-17-30)28-22-36-33(37-23-28)27-12-10-25(11-13-27)21-29(24-39)38-34(40)31-18-19-32(42-31)35(2,3)4/h10-19,22-24,29H,5-9,20-21H2,1-4H3,(H,38,40) |
| InChIKey | BJGWQJJIXAGQAZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.80 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|