C34H40N4O3S — CID 155130742
5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]-1,3-thiazole-2-carboxamide (PubChem CID 155130742) has the molecular formula C34H40N4O3S and a molecular weight of 584.79 g/mol. Its IUPAC name is 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]-1,3-thiazole-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 155130742 |
| Molecular Formula | C34H40N4O3S |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 5-tert-butyl-N-[1-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-3-oxopropan-2-yl]-1,3-thiazole-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(C=O)NC(=O)c4ncc(C(C)(C)C)s4)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H40N4O3S/c1-5-6-7-8-9-18-41-29-16-14-25(15-17-29)27-20-35-31(36-21-27)26-12-10-24(11-13-26)19-28(23-39)38-32(40)33-37-22-30(42-33)34(2,3)4/h10-17,20-23,28H,5-9,18-19H2,1-4H3,(H,38,40) |
| InChIKey | VGMCJLGRVZPCPW-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|