C35H43N3O3S — CID 123235881
2-[(5-tert-butylthiophen-2-yl)methylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 123235881) has the molecular formula C35H43N3O3S and a molecular weight of 585.81 g/mol. Its IUPAC name is 2-[(5-tert-butylthiophen-2-yl)methylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | 2-[(5-tert-butylthiophen-2-yl)methylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123235881 |
| Molecular Formula | C35H43N3O3S |
| Molecular Weight | 585.81 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 2-[(5-tert-butylthiophen-2-yl)methylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NCc4ccc(C(C)(C)C)s4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H43N3O3S/c1-5-6-7-8-9-20-41-29-16-14-26(15-17-29)28-22-37-33(38-23-28)27-12-10-25(11-13-27)21-31(34(39)40)36-24-30-18-19-32(42-30)35(2,3)4/h10-19,22-23,31,36H,5-9,20-21,24H2,1-4H3,(H,39,40) |
| InChIKey | IYPVXPKSXHNPMG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.81 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|