C42H56N4O5S — CID 145098848
2-[[(2S)-2-[(5-tert-butylthiophen-2-yl)methoxymethylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]hexanoic acid (PubChem CID 145098848) has the molecular formula C42H56N4O5S and a molecular weight of 729.00 g/mol. Its IUPAC name is 2-[[(2S)-2-[(5-tert-butylthiophen-2-yl)methoxymethylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]hexanoic acid.
| Compound Name | 2-[[(2S)-2-[(5-tert-butylthiophen-2-yl)methoxymethylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145098848 |
| Molecular Formula | C42H56N4O5S |
| Molecular Weight | 729.00 g/mol |
| Exact Mass | 728.40 |
| IUPAC Name | 2-[[(2S)-2-[(5-tert-butylthiophen-2-yl)methoxymethylamino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]hexanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NCOCc4ccc(C(C)(C)C)s4)C(=O)NC(CCCC)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C42H56N4O5S/c1-6-8-10-11-12-24-51-34-20-18-31(19-21-34)33-26-43-39(44-27-33)32-16-14-30(15-17-32)25-37(40(47)46-36(41(48)49)13-9-7-2)45-29-50-28-35-22-23-38(52-35)42(3,4)5/h14-23,26-27,36-37,45H,6-13,24-25,28-29H2,1-5H3,(H,46,47)(H,48,49)/t36?,37-/m0/s1 |
| InChIKey | LCUCZIHCJMRIRM-RWXFGYRSSA-N |
| XLogP | 8.95 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.00 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|