C44H50N4O4S — CID 144758587
5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]propan-2-yl]thiophene-2-carboxamide (PubChem CID 144758587) has the molecular formula C44H50N4O4S and a molecular weight of 730.98 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]propan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 144758587 |
| Molecular Formula | C44H50N4O4S |
| Molecular Weight | 730.98 g/mol |
| Exact Mass | 730.36 |
| IUPAC Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]propan-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NC(C=O)Cc4ccccc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C44H50N4O4S/c1-5-6-7-8-12-25-52-37-21-19-33(20-22-37)35-28-45-41(46-29-35)34-17-15-32(16-18-34)27-38(48-43(51)39-23-24-40(53-39)44(2,3)4)42(50)47-36(30-49)26-31-13-10-9-11-14-31/h9-11,13-24,28-30,36,38H,5-8,12,25-27H2,1-4H3,(H,47,50)(H,48,51) |
| InChIKey | VFMHEWKOPKAWBJ-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.98 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|