C41H46N4O3S2 — CID 144758473
5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-(phenylsulfanylamino)propan-2-yl]thiophene-2-carboxamide (PubChem CID 144758473) has the molecular formula C41H46N4O3S2 and a molecular weight of 706.98 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-(phenylsulfanylamino)propan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-(phenylsulfanylamino)propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 144758473 |
| Molecular Formula | C41H46N4O3S2 |
| Molecular Weight | 706.98 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-(phenylsulfanylamino)propan-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NSc4ccccc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C41H46N4O3S2/c1-5-6-7-8-12-25-48-33-21-19-30(20-22-33)32-27-42-38(43-28-32)31-17-15-29(16-18-31)26-35(39(46)45-50-34-13-10-9-11-14-34)44-40(47)36-23-24-37(49-36)41(2,3)4/h9-11,13-24,27-28,35H,5-8,12,25-26H2,1-4H3,(H,44,47)(H,45,46) |
| InChIKey | QGRSKDSEPVYVNQ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.98 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|