C42H53N3O5S — CID 158454483
2-[[(2R)-4-(5-tert-butylthiophen-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 158454483) has the molecular formula C42H53N3O5S and a molecular weight of 711.97 g/mol. Its IUPAC name is 2-[[(2R)-4-(5-tert-butylthiophen-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | 2-[[(2R)-4-(5-tert-butylthiophen-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 158454483 |
| Molecular Formula | C42H53N3O5S |
| Molecular Weight | 711.97 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | 2-[[(2R)-4-(5-tert-butylthiophen-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ccc(C(C)(C)C)s4)C(=O)NC(CCCC)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C42H53N3O5S/c1-6-8-10-11-12-24-50-34-20-18-30(19-21-34)33-27-43-39(44-28-33)31-16-14-29(15-17-31)25-32(40(47)45-35(41(48)49)13-9-7-2)26-36(46)37-22-23-38(51-37)42(3,4)5/h14-23,27-28,32,35H,6-13,24-26H2,1-5H3,(H,45,47)(H,48,49)/t32-,35?/m1/s1 |
| InChIKey | YDXOCYANIRSXFE-WXZYJURRSA-N |
| XLogP | 9.71 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.97 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|