C35H41N3O4S — CID 157401255
(2R)-4-(5-tert-butyl-1,3-thiazol-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid (PubChem CID 157401255) has the molecular formula C35H41N3O4S and a molecular weight of 599.80 g/mol. Its IUPAC name is (2R)-4-(5-tert-butyl-1,3-thiazol-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(5-tert-butyl-1,3-thiazol-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157401255 |
| Molecular Formula | C35H41N3O4S |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | (2R)-4-(5-tert-butyl-1,3-thiazol-2-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ncc(C(C)(C)C)s4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C35H41N3O4S/c1-5-6-7-8-9-18-42-29-16-14-25(15-17-29)28-21-36-32(37-22-28)26-12-10-24(11-13-26)19-27(34(40)41)20-30(39)33-38-23-31(43-33)35(2,3)4/h10-17,21-23,27H,5-9,18-20H2,1-4H3,(H,40,41)/t27-/m1/s1 |
| InChIKey | TWNYIIINVJABCF-HHHXNRCGSA-N |
| XLogP | 8.43 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|