C34H35ClN2O4 — CID 148861386
(2R)-4-(4-chlorophenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid (PubChem CID 148861386) has the molecular formula C34H35ClN2O4 and a molecular weight of 571.12 g/mol. Its IUPAC name is (2R)-4-(4-chlorophenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-chlorophenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 148861386 |
| Molecular Formula | C34H35ClN2O4 |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | (2R)-4-(4-chlorophenyl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxobutanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ccc(Cl)cc4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H35ClN2O4/c1-2-3-4-5-6-19-41-31-17-13-25(14-18-31)29-22-36-33(37-23-29)27-9-7-24(8-10-27)20-28(34(39)40)21-32(38)26-11-15-30(35)16-12-26/h7-18,22-23,28H,2-6,19-21H2,1H3,(H,39,40)/t28-/m1/s1 |
| InChIKey | OZJZRCHAVHSGAM-MUUNZHRXSA-N |
| XLogP | 8.33 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|