C38H43N3O6 — CID 158084019
(2R)-2-[[(2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-(4-methoxyphenyl)-4-oxobutanoyl]amino]propanoic acid (PubChem CID 158084019) has the molecular formula C38H43N3O6 and a molecular weight of 637.78 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-(4-methoxyphenyl)-4-oxobutanoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-(4-methoxyphenyl)-4-oxobutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 158084019 |
| Molecular Formula | C38H43N3O6 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-(4-methoxyphenyl)-4-oxobutanoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ccc(OC)cc4)C(=O)N[C@H](C)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C38H43N3O6/c1-4-5-6-7-8-21-47-34-19-13-28(14-20-34)32-24-39-36(40-25-32)30-11-9-27(10-12-30)22-31(37(43)41-26(2)38(44)45)23-35(42)29-15-17-33(46-3)18-16-29/h9-20,24-26,31H,4-8,21-23H2,1-3H3,(H,41,43)(H,44,45)/t26-,31-/m1/s1 |
| InChIKey | FNHJIBIETMLUFE-MXBOTTGLSA-N |
| XLogP | 7.19 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|