C40H40N2O4 — CID 149478606
(2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxo-4-(4-phenylphenyl)butanoic acid (PubChem CID 149478606) has the molecular formula C40H40N2O4 and a molecular weight of 612.77 g/mol. Its IUPAC name is (2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxo-4-(4-phenylphenyl)butanoic acid.
| Compound Name | (2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxo-4-(4-phenylphenyl)butanoic acid |
|---|---|
| PubChem CID | 149478606 |
| Molecular Formula | C40H40N2O4 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.30 |
| IUPAC Name | (2R)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-4-oxo-4-(4-phenylphenyl)butanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ccc(-c5ccccc5)cc4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C40H40N2O4/c1-2-3-4-5-9-24-46-37-22-20-32(21-23-37)36-27-41-39(42-28-36)34-14-12-29(13-15-34)25-35(40(44)45)26-38(43)33-18-16-31(17-19-33)30-10-7-6-8-11-30/h6-8,10-23,27-28,35H,2-5,9,24-26H2,1H3,(H,44,45)/t35-/m1/s1 |
| InChIKey | ZCUIIDXPKZDEHN-PGUFJCEWSA-N |
| XLogP | 9.34 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|