C30H38N4O4 — CID 135264288
(2S)-2-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]propanoic acid (PubChem CID 135264288) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135264288 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | (2S)-2-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC)C(=O)N[C@@H](C)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C30H38N4O4/c1-4-5-6-7-8-17-38-26-15-13-23(14-16-26)25-19-32-28(33-20-25)24-11-9-22(10-12-24)18-27(31-3)29(35)34-21(2)30(36)37/h9-16,19-21,27,31H,4-8,17-18H2,1-3H3,(H,34,35)(H,36,37)/t21-,27-/m0/s1 |
| InChIKey | OQTVUTFRQRHAQK-IDISGSTGSA-N |
| XLogP | 4.88 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|