C34H44N4O4 — CID 138545571
3-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 138545571) has the molecular formula C34H44N4O4 and a molecular weight of 572.75 g/mol. Its IUPAC name is 3-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 138545571 |
| Molecular Formula | C34H44N4O4 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 3-[[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-2-(methylamino)propanoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC)C(=O)NC4CCCC(C(=O)O)C4)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H44N4O4/c1-3-4-5-6-7-19-42-30-17-15-25(16-18-30)28-22-36-32(37-23-28)26-13-11-24(12-14-26)20-31(35-2)33(39)38-29-10-8-9-27(21-29)34(40)41/h11-18,22-23,27,29,31,35H,3-10,19-21H2,1-2H3,(H,38,39)(H,40,41)/t27?,29?,31-/m0/s1 |
| InChIKey | DAUJKHVSCUWBLE-BZWKOBJRSA-N |
| XLogP | 6.05 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|