C34H43N3O4 — CID 155085009
1-[2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-3-methylpentanoyl]azetidine-3-carboxylic acid (PubChem CID 155085009) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is 1-[2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-3-methylpentanoyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-3-methylpentanoyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155085009 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | 1-[2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]-3-methylpentanoyl]azetidine-3-carboxylic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(C(=O)N4CC(C(=O)O)C4)C(C)CC)cc3)nc2)cc1 |
| InChI | InChI=1S/C34H43N3O4/c1-4-6-7-8-9-18-41-30-16-14-26(15-17-30)28-20-35-32(36-21-28)27-12-10-25(11-13-27)19-31(24(3)5-2)33(38)37-22-29(23-37)34(39)40/h10-17,20-21,24,29,31H,4-9,18-19,22-23H2,1-3H3,(H,39,40) |
| InChIKey | KCXJWVVZRAQNLS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|