C37H44N4O4 — CID 123847149
2-[[4-(butylamino)benzoyl]amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid (PubChem CID 123847149) has the molecular formula C37H44N4O4 and a molecular weight of 608.78 g/mol. Its IUPAC name is 2-[[4-(butylamino)benzoyl]amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid.
| Compound Name | 2-[[4-(butylamino)benzoyl]amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123847149 |
| Molecular Formula | C37H44N4O4 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | 2-[[4-(butylamino)benzoyl]amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(NCCCC)cc4)C(=O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C37H44N4O4/c1-3-5-7-8-9-23-45-33-20-16-28(17-21-33)31-25-39-35(40-26-31)29-12-10-27(11-13-29)24-34(37(43)44)41-36(42)30-14-18-32(19-15-30)38-22-6-4-2/h10-21,25-26,34,38H,3-9,22-24H2,1-2H3,(H,41,42)(H,43,44) |
| InChIKey | BOHOODLSNSYVLR-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|