C41H52N4O3S — CID 147554820
(2R)-4-(5-tert-butylthiophen-2-yl)-1-(1,4-diazepan-1-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]butane-1,4-dione (PubChem CID 147554820) has the molecular formula C41H52N4O3S and a molecular weight of 680.96 g/mol. Its IUPAC name is (2R)-4-(5-tert-butylthiophen-2-yl)-1-(1,4-diazepan-1-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]butane-1,4-dione.
| Compound Name | (2R)-4-(5-tert-butylthiophen-2-yl)-1-(1,4-diazepan-1-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]butane-1,4-dione |
|---|---|
| PubChem CID | 147554820 |
| Molecular Formula | C41H52N4O3S |
| Molecular Weight | 680.96 g/mol |
| Exact Mass | 680.38 |
| IUPAC Name | (2R)-4-(5-tert-butylthiophen-2-yl)-1-(1,4-diazepan-1-yl)-2-[[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]methyl]butane-1,4-dione |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](CC(=O)c4ccc(C(C)(C)C)s4)C(=O)N4CCCNCC4)cc3)nc2)cc1 |
| InChI | InChI=1S/C41H52N4O3S/c1-5-6-7-8-9-25-48-35-17-15-31(16-18-35)34-28-43-39(44-29-34)32-13-11-30(12-14-32)26-33(40(47)45-23-10-21-42-22-24-45)27-36(46)37-19-20-38(49-37)41(2,3)4/h11-20,28-29,33,42H,5-10,21-27H2,1-4H3/t33-/m1/s1 |
| InChIKey | FRLYTGNYTOSKRP-MGBGTMOVSA-N |
| XLogP | 8.77 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.96 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|