C45H54N4O5S — CID 155373718
(2S,4Z)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid (PubChem CID 155373718) has the molecular formula C45H54N4O5S and a molecular weight of 763.02 g/mol. Its IUPAC name is (2S,4Z)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid.
| Compound Name | (2S,4Z)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid |
|---|---|
| PubChem CID | 155373718 |
| Molecular Formula | C45H54N4O5S |
| Molecular Weight | 763.02 g/mol |
| Exact Mass | 762.38 |
| IUPAC Name | (2S,4Z)-2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoyl]amino]-4-[(Z)-prop-1-enyl]hepta-4,6-dienoic acid |
| SMILES | C=C/C=C(\C=C/C)C[C@H](NC(=O)C(Cc1ccc(-c2ncc(-c3ccc(OCCCCCCC)cc3)cn2)cc1)NC(=O)c1ccc(C(C)(C)C)s1)C(=O)O |
| InChI | InChI=1S/C45H54N4O5S/c1-7-10-11-12-13-26-54-36-22-20-33(21-23-36)35-29-46-41(47-30-35)34-18-16-32(17-19-34)27-37(48-43(51)39-24-25-40(55-39)45(4,5)6)42(50)49-38(44(52)53)28-31(14-8-2)15-9-3/h8-9,14-25,29-30,37-38H,2,7,10-13,26-28H2,1,3-6H3,(H,48,51)(H,49,50)(H,52,53)/b15-9-,31-14+/t37?,38-/m0/s1 |
| InChIKey | RFDQWRHECMBRQU-KRJJPGPLSA-N |
| XLogP | 9.51 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.02 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|