C37H44N4O5S — CID 123922062
2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrazin-2-yl]phenyl]propanoyl]amino]acetic acid (PubChem CID 123922062) has the molecular formula C37H44N4O5S and a molecular weight of 656.85 g/mol. Its IUPAC name is 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrazin-2-yl]phenyl]propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrazin-2-yl]phenyl]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 123922062 |
| Molecular Formula | C37H44N4O5S |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | 2-[[2-[(5-tert-butylthiophene-2-carbonyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrazin-2-yl]phenyl]propanoyl]amino]acetic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)NCC(=O)O)cc3)cn2)cc1 |
| InChI | InChI=1S/C37H44N4O5S/c1-5-6-7-8-9-20-46-28-16-14-27(15-17-28)31-23-38-30(22-39-31)26-12-10-25(11-13-26)21-29(35(44)40-24-34(42)43)41-36(45)32-18-19-33(47-32)37(2,3)4/h10-19,22-23,29H,5-9,20-21,24H2,1-4H3,(H,40,44)(H,41,45)(H,42,43) |
| InChIKey | OJKUPSSSBYLEFO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|