C37H44N4O4 — CID 155084975
N-[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1,1-dihydroxypropan-2-yl]-3-pyrrolidin-1-ylbenzamide (PubChem CID 155084975) has the molecular formula C37H44N4O4 and a molecular weight of 608.78 g/mol. Its IUPAC name is N-[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1,1-dihydroxypropan-2-yl]-3-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1,1-dihydroxypropan-2-yl]-3-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 155084975 |
| Molecular Formula | C37H44N4O4 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | N-[(2S)-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1,1-dihydroxypropan-2-yl]-3-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC(=O)c4cccc(N5CCCC5)c4)C(O)O)cc3)nc2)cc1 |
| InChI | InChI=1S/C37H44N4O4/c1-2-3-4-5-8-22-45-33-18-16-28(17-19-33)31-25-38-35(39-26-31)29-14-12-27(13-15-29)23-34(37(43)44)40-36(42)30-10-9-11-32(24-30)41-20-6-7-21-41/h9-19,24-26,34,37,43-44H,2-8,20-23H2,1H3,(H,40,42)/t34-/m0/s1 |
| InChIKey | GBSBLAZVOYKJIM-UMSFTDKQSA-N |
| XLogP | 6.41 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|