C45H53N5O5 — CID 135264289
3-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-hydroxypropyl]amino]-3-pyridin-3-ylpropanoic acid (PubChem CID 135264289) has the molecular formula C45H53N5O5 and a molecular weight of 743.95 g/mol. Its IUPAC name is 3-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-hydroxypropyl]amino]-3-pyridin-3-ylpropanoic acid.
| Compound Name | 3-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-hydroxypropyl]amino]-3-pyridin-3-ylpropanoic acid |
|---|---|
| PubChem CID | 135264289 |
| Molecular Formula | C45H53N5O5 |
| Molecular Weight | 743.95 g/mol |
| Exact Mass | 743.40 |
| IUPAC Name | 3-[[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-hydroxypropyl]amino]-3-pyridin-3-ylpropanoic acid |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(C[C@H](NC(=O)c4ccc(C(C)(C)C)cc4)C(O)NC(CC(=O)O)c4cccnc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C45H53N5O5/c1-5-6-7-8-9-25-55-38-22-18-32(19-23-38)36-29-47-42(48-30-36)33-14-12-31(13-15-33)26-40(50-43(53)34-16-20-37(21-17-34)45(2,3)4)44(54)49-39(27-41(51)52)35-11-10-24-46-28-35/h10-24,28-30,39-40,44,49,54H,5-9,25-27H2,1-4H3,(H,50,53)(H,51,52)/t39?,40-,44?/m0/s1 |
| InChIKey | IXGGJBZCSHGODW-LZCHGWCYSA-N |
| XLogP | 8.32 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.95 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|