C19H15N3O5 — CID 134170556
methyl 2-[(4-cyanatobenzoyl)amino]-3-(4-cyanatophenyl)propanoate (PubChem CID 134170556) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is methyl 2-[(4-cyanatobenzoyl)amino]-3-(4-cyanatophenyl)propanoate.
| Compound Name | methyl 2-[(4-cyanatobenzoyl)amino]-3-(4-cyanatophenyl)propanoate |
|---|---|
| PubChem CID | 134170556 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | methyl 2-[(4-cyanatobenzoyl)amino]-3-(4-cyanatophenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(OC#N)cc1)NC(=O)c1ccc(OC#N)cc1 |
| InChI | InChI=1S/C19H15N3O5/c1-25-19(24)17(10-13-2-6-15(7-3-13)26-11-20)22-18(23)14-4-8-16(9-5-14)27-12-21/h2-9,17H,10H2,1H3,(H,22,23) |
| InChIKey | RIXLFGCWEFPONN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|