C21H25N3O4 — CID 154072458
2-[(4-tert-butylbenzoyl)amino]-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid (PubChem CID 154072458) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 154072458 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-3-[4-(N'-hydroxycarbamimidoyl)phenyl]propanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(Cc2ccc(C(N)=NO)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-21(2,3)16-10-8-15(9-11-16)19(25)23-17(20(26)27)12-13-4-6-14(7-5-13)18(22)24-28/h4-11,17,28H,12H2,1-3H3,(H2,22,24)(H,23,25)(H,26,27) |
| InChIKey | NNKNKKLIEJJCSF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|