C36H39N3O3 — CID 123994531
2-[(4-tert-butylbenzoyl)amino]-3-[4-[4-(4-phenylphenyl)piperazin-1-yl]phenyl]propanoic acid (PubChem CID 123994531) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is 2-[(4-tert-butylbenzoyl)amino]-3-[4-[4-(4-phenylphenyl)piperazin-1-yl]phenyl]propanoic acid.
| Compound Name | 2-[(4-tert-butylbenzoyl)amino]-3-[4-[4-(4-phenylphenyl)piperazin-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123994531 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | 2-[(4-tert-butylbenzoyl)amino]-3-[4-[4-(4-phenylphenyl)piperazin-1-yl]phenyl]propanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(Cc2ccc(N3CCN(c4ccc(-c5ccccc5)cc4)CC3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C36H39N3O3/c1-36(2,3)30-15-11-29(12-16-30)34(40)37-33(35(41)42)25-26-9-17-31(18-10-26)38-21-23-39(24-22-38)32-19-13-28(14-20-32)27-7-5-4-6-8-27/h4-20,33H,21-25H2,1-3H3,(H,37,40)(H,41,42) |
| InChIKey | RDIXLVYGXVCQFK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|