C16H21N3O5 — CID 170451593
3-[4-(4-acetylpiperazin-1-yl)phenyl]-2-(carboxyamino)propanoic acid (PubChem CID 170451593) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-[4-(4-acetylpiperazin-1-yl)phenyl]-2-(carboxyamino)propanoic acid.
| Compound Name | 3-[4-(4-acetylpiperazin-1-yl)phenyl]-2-(carboxyamino)propanoic acid |
|---|---|
| PubChem CID | 170451593 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-[4-(4-acetylpiperazin-1-yl)phenyl]-2-(carboxyamino)propanoic acid |
| SMILES | CC(=O)N1CCN(c2ccc(CC(NC(=O)O)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C16H21N3O5/c1-11(20)18-6-8-19(9-7-18)13-4-2-12(3-5-13)10-14(15(21)22)17-16(23)24/h2-5,14,17H,6-10H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | FTIZWKQUZZDIKF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|