C19H22N4O3 — CID 100925677
2-[[4-[[(N'-methylcarbamimidoyl)amino]methyl]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 100925677) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[[4-[[(N'-methylcarbamimidoyl)amino]methyl]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-[[(N'-methylcarbamimidoyl)amino]methyl]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 100925677 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[[4-[[(N'-methylcarbamimidoyl)amino]methyl]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | C/N=C(\N)NCc1ccc(C(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C19H22N4O3/c1-21-19(20)22-12-14-7-9-15(10-8-14)17(24)23-16(18(25)26)11-13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3,(H,23,24)(H,25,26)(H3,20,21,22) |
| InChIKey | AYTFNEVTQDKNNZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|