C21H27NO3 — CID 90179776
methyl 4-[2-(4-tert-butylphenyl)-3-(hydroxyamino)propyl]benzoate (PubChem CID 90179776) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl 4-[2-(4-tert-butylphenyl)-3-(hydroxyamino)propyl]benzoate.
| Compound Name | methyl 4-[2-(4-tert-butylphenyl)-3-(hydroxyamino)propyl]benzoate |
|---|---|
| PubChem CID | 90179776 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl 4-[2-(4-tert-butylphenyl)-3-(hydroxyamino)propyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(CNO)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-21(2,3)19-11-9-16(10-12-19)18(14-22-24)13-15-5-7-17(8-6-15)20(23)25-4/h5-12,18,22,24H,13-14H2,1-4H3 |
| InChIKey | CPROESSCSBCCSM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|