C37H45NO7 — CID 86689660
[2-(4-heptoxyphenyl)-2-oxoethyl] 4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate (PubChem CID 86689660) has the molecular formula C37H45NO7 and a molecular weight of 615.77 g/mol. Its IUPAC name is [2-(4-heptoxyphenyl)-2-oxoethyl] 4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate.
| Compound Name | [2-(4-heptoxyphenyl)-2-oxoethyl] 4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 86689660 |
| Molecular Formula | C37H45NO7 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | [2-(4-heptoxyphenyl)-2-oxoethyl] 4-[(2S)-2-[(4-tert-butylbenzoyl)amino]-3-methoxy-3-oxopropyl]benzoate |
| SMILES | CCCCCCCOc1ccc(C(=O)COC(=O)c2ccc(C[C@H](NC(=O)c3ccc(C(C)(C)C)cc3)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C37H45NO7/c1-6-7-8-9-10-23-44-31-21-17-27(18-22-31)33(39)25-45-35(41)29-13-11-26(12-14-29)24-32(36(42)43-5)38-34(40)28-15-19-30(20-16-28)37(2,3)4/h11-22,32H,6-10,23-25H2,1-5H3,(H,38,40)/t32-/m0/s1 |
| InChIKey | FKMHZQRDMFMMQU-YTTGMZPUSA-N |
| XLogP | 6.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|