C19H23FN2O2S2 — CID 11855580
N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-2-(4-propan-2-ylphenyl)ethanethioamide (PubChem CID 11855580) has the molecular formula C19H23FN2O2S2 and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-2-(4-propan-2-ylphenyl)ethanethioamide.
| Compound Name | N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-2-(4-propan-2-ylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 11855580 |
| Molecular Formula | C19H23FN2O2S2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]-2-(4-propan-2-ylphenyl)ethanethioamide |
| SMILES | CC(C)c1ccc(CC(=S)NCc2ccc(NS(C)(=O)=O)c(F)c2)cc1 |
| InChI | InChI=1S/C19H23FN2O2S2/c1-13(2)16-7-4-14(5-8-16)11-19(25)21-12-15-6-9-18(17(20)10-15)22-26(3,23)24/h4-10,13,22H,11-12H2,1-3H3,(H,21,25) |
| InChIKey | GADMDHLBFKVUTC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|