C17H16ClFN2O2S2 — CID 11855578
(E)-3-(4-chlorophenyl)-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide (PubChem CID 11855578) has the molecular formula C17H16ClFN2O2S2 and a molecular weight of 398.91 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide |
|---|---|
| PubChem CID | 11855578 |
| Molecular Formula | C17H16ClFN2O2S2 |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enethioamide |
| SMILES | CS(=O)(=O)Nc1ccc(CNC(=S)/C=C/c2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C17H16ClFN2O2S2/c1-25(22,23)21-16-8-4-13(10-15(16)19)11-20-17(24)9-5-12-2-6-14(18)7-3-12/h2-10,21H,11H2,1H3,(H,20,24)/b9-5+ |
| InChIKey | YXLWFIMOHWPUAO-WEVVVXLNSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|