C20H19F3N2O3S — CID 11852583
(E)-N-[[3-ethenyl-4-(methanesulfonamido)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 11852583) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is (E)-N-[[3-ethenyl-4-(methanesulfonamido)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-ethenyl-4-(methanesulfonamido)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11852583 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-N-[[3-ethenyl-4-(methanesulfonamido)phenyl]methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=Cc1cc(CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C20H19F3N2O3S/c1-3-16-12-15(6-10-18(16)25-29(2,27)28)13-24-19(26)11-7-14-4-8-17(9-5-14)20(21,22)23/h3-12,25H,1,13H2,2H3,(H,24,26)/b11-7+ |
| InChIKey | OKUCNMFMEMISOX-YRNVUSSQSA-N |
| XLogP | 4.05 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|