C26H33FN2O5S — CID 11852682
(E)-3-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-N-[[3-ethenyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide (PubChem CID 11852682) has the molecular formula C26H33FN2O5S and a molecular weight of 504.62 g/mol. Its IUPAC name is (E)-3-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-N-[[3-ethenyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-N-[[3-ethenyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 11852682 |
| Molecular Formula | C26H33FN2O5S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (E)-3-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-N-[[3-ethenyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]prop-2-enamide |
| SMILES | C=Cc1cc(CNC(=O)/C=C/c2ccc(C(C)(C)C)cc2OCCOC)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C26H33FN2O5S/c1-7-19-14-18(15-22(27)25(19)29-35(6,31)32)17-28-24(30)11-9-20-8-10-21(26(2,3)4)16-23(20)34-13-12-33-5/h7-11,14-16,29H,1,12-13,17H2,2-6H3,(H,28,30)/b11-9+ |
| InChIKey | APQDRAVIIMVWPE-PKNBQFBNSA-N |
| XLogP | 4.49 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|