C21H20F4N4O5S — CID 59598215
(E)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 59598215) has the molecular formula C21H20F4N4O5S and a molecular weight of 516.47 g/mol. Its IUPAC name is (E)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 59598215 |
| Molecular Formula | C21H20F4N4O5S |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (E)-N-[[3-cyano-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(2-methoxyethoxy)-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | COCCOc1nc(C(F)(F)F)ccc1/C=C/C(=O)NCc1cc(F)c(NS(C)(=O)=O)c(C#N)c1 |
| InChI | InChI=1S/C21H20F4N4O5S/c1-33-7-8-34-20-14(3-5-17(28-20)21(23,24)25)4-6-18(30)27-12-13-9-15(11-26)19(16(22)10-13)29-35(2,31)32/h3-6,9-10,29H,7-8,12H2,1-2H3,(H,27,30)/b6-4+ |
| InChIKey | HZVQLIUKZDUHSM-GQCTYLIASA-N |
| XLogP | 2.84 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|