C23H22F4N4O4S — CID 74332382
N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 74332382) has the molecular formula C23H22F4N4O4S and a molecular weight of 526.51 g/mol. Its IUPAC name is N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 74332382 |
| Molecular Formula | C23H22F4N4O4S |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-morpholin-4-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(F)(F)F)nc2N2CCOCC2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C23H22F4N4O4S/c1-3-16-12-15(13-18(24)21(16)30-36(2,33)34)14-28-20(32)7-5-17-4-6-19(23(25,26)27)29-22(17)31-8-10-35-11-9-31/h1,4-7,12-13,30H,8-11,14H2,2H3,(H,28,32) |
| InChIKey | VMQLWMTZDMPKAG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|