C22H23FN4O4S — CID 59598262
(E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide (PubChem CID 59598262) has the molecular formula C22H23FN4O4S and a molecular weight of 458.52 g/mol. Its IUPAC name is (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 59598262 |
| Molecular Formula | C22H23FN4O4S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-(2-morpholin-4-yl-3-pyridinyl)prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2cccnc2N2CCOCC2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C22H23FN4O4S/c1-3-17-13-16(14-19(23)21(17)26-32(2,29)30)15-25-20(28)7-6-18-5-4-8-24-22(18)27-9-11-31-12-10-27/h1,4-8,13-14,26H,9-12,15H2,2H3,(H,25,28)/b7-6+ |
| InChIKey | MLFZSNNBLQIILD-VOTSOKGWSA-N |
| XLogP | 1.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|