C22H17F4N5O3S — CID 59598255
(E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrazol-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 59598255) has the molecular formula C22H17F4N5O3S and a molecular weight of 507.47 g/mol. Its IUPAC name is (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrazol-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrazol-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 59598255 |
| Molecular Formula | C22H17F4N5O3S |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.10 |
| IUPAC Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrazol-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2ccc(C(F)(F)F)nc2-n2cccn2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C22H17F4N5O3S/c1-3-15-11-14(12-17(23)20(15)30-35(2,33)34)13-27-19(32)8-6-16-5-7-18(22(24,25)26)29-21(16)31-10-4-9-28-31/h1,4-12,30H,13H2,2H3,(H,27,32)/b8-6+ |
| InChIKey | ZVUCMLCRYUCQGM-SOFGYWHQSA-N |
| XLogP | 3.11 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|