C23H22F4N4O3S — CID 24995984
(E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrrolidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 24995984) has the molecular formula C23H22F4N4O3S and a molecular weight of 510.51 g/mol. Its IUPAC name is (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrrolidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrrolidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 24995984 |
| Molecular Formula | C23H22F4N4O3S |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-pyrrolidin-1-yl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2ccc(C(F)(F)F)nc2N2CCCC2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C23H22F4N4O3S/c1-3-16-12-15(13-18(24)21(16)30-35(2,33)34)14-28-20(32)9-7-17-6-8-19(23(25,26)27)29-22(17)31-10-4-5-11-31/h1,6-9,12-13,30H,4-5,10-11,14H2,2H3,(H,28,32)/b9-7+ |
| InChIKey | BPLDPBYMSOHPTB-VQHVLOKHSA-N |
| XLogP | 3.52 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|