C21H15F4N3O3S2 — CID 142698463
N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-ethynylsulfanyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide (PubChem CID 142698463) has the molecular formula C21H15F4N3O3S2 and a molecular weight of 497.50 g/mol. Its IUPAC name is N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-ethynylsulfanyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-ethynylsulfanyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 142698463 |
| Molecular Formula | C21H15F4N3O3S2 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-ethynylsulfanyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enamide |
| SMILES | C#CSc1nc(C(F)(F)F)ccc1C=CC(=O)NCc1cc(F)c(NS(C)(=O)=O)c(C#C)c1 |
| InChI | InChI=1S/C21H15F4N3O3S2/c1-4-14-10-13(11-16(22)19(14)28-33(3,30)31)12-26-18(29)9-7-15-6-8-17(21(23,24)25)27-20(15)32-5-2/h1-2,6-11,28H,12H2,3H3,(H,26,29) |
| InChIKey | NJDPQWWJKFVFID-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|