C23H22F4N2O3S — CID 87180917
(Z)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 87180917) has the molecular formula C23H22F4N2O3S and a molecular weight of 482.50 g/mol. Its IUPAC name is (Z)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87180917 |
| Molecular Formula | C23H22F4N2O3S |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (Z)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propyl-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C\c2ccc(C(F)(F)F)cc2CCC)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C23H22F4N2O3S/c1-4-6-18-13-19(23(25,26)27)9-7-17(18)8-10-21(30)28-14-15-11-16(5-2)22(20(24)12-15)29-33(3,31)32/h2,7-13,29H,4,6,14H2,1,3H3,(H,28,30)/b10-8- |
| InChIKey | HYYGLPSWZLXIJA-NTMALXAHSA-N |
| XLogP | 4.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|