C25H25F4N3O4S — CID 59598109
(E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(3-methoxypyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 59598109) has the molecular formula C25H25F4N3O4S and a molecular weight of 539.55 g/mol. Its IUPAC name is (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(3-methoxypyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(3-methoxypyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59598109 |
| Molecular Formula | C25H25F4N3O4S |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (E)-N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-(3-methoxypyrrolidin-1-yl)-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2N2CCC(OC)C2)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C25H25F4N3O4S/c1-4-17-11-16(12-21(26)24(17)31-37(3,34)35)14-30-23(33)8-6-18-5-7-19(25(27,28)29)13-22(18)32-10-9-20(15-32)36-2/h1,5-8,11-13,20,31H,9-10,14-15H2,2-3H3,(H,30,33)/b8-6+ |
| InChIKey | UJYXOSIQSOOUSR-SOFGYWHQSA-N |
| XLogP | 3.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|