C23H22F4N2O4S — CID 74936901
N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 74936901) has the molecular formula C23H22F4N2O4S and a molecular weight of 498.50 g/mol. Its IUPAC name is N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 74936901 |
| Molecular Formula | C23H22F4N2O4S |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-[[3-ethynyl-5-fluoro-4-(methanesulfonamido)phenyl]methyl]-3-[2-propoxy-4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C#Cc1cc(CNC(=O)C=Cc2ccc(C(F)(F)F)cc2OCCC)cc(F)c1NS(C)(=O)=O |
| InChI | InChI=1S/C23H22F4N2O4S/c1-4-10-33-20-13-18(23(25,26)27)8-6-17(20)7-9-21(30)28-14-15-11-16(5-2)22(19(24)12-15)29-34(3,31)32/h2,6-9,11-13,29H,4,10,14H2,1,3H3,(H,28,30) |
| InChIKey | ARTDPUBPRNCCIH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|